C13H21BrClN3 — CID 106123739
N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-1-(4-chlorocyclohexyl)methanamine (PubChem CID 106123739) has the molecular formula C13H21BrClN3 and a molecular weight of 334.69 g/mol. Its IUPAC name is N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-1-(4-chlorocyclohexyl)methanamine.
| Compound Name | N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-1-(4-chlorocyclohexyl)methanamine |
|---|---|
| PubChem CID | 106123739 |
| Molecular Formula | C13H21BrClN3 |
| Molecular Weight | 334.69 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | N-[(4-bromo-1,3-dimethylpyrazol-5-yl)methyl]-1-(4-chlorocyclohexyl)methanamine |
| SMILES | Cc1nn(C)c(CNCC2CCC(Cl)CC2)c1Br |
| InChI | InChI=1S/C13H21BrClN3/c1-9-13(14)12(18(2)17-9)8-16-7-10-3-5-11(15)6-4-10/h10-11,16H,3-8H2,1-2H3 |
| InChIKey | BANJCBUBUMFKMM-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.69 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|