C11H18ClN3 — CID 106124735
N-(4-chloropentyl)-3,6-dimethylpyrazin-2-amine (PubChem CID 106124735) has the molecular formula C11H18ClN3 and a molecular weight of 227.74 g/mol. Its IUPAC name is N-(4-chloropentyl)-3,6-dimethylpyrazin-2-amine.
| Compound Name | N-(4-chloropentyl)-3,6-dimethylpyrazin-2-amine |
|---|---|
| PubChem CID | 106124735 |
| Molecular Formula | C11H18ClN3 |
| Molecular Weight | 227.74 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | N-(4-chloropentyl)-3,6-dimethylpyrazin-2-amine |
| SMILES | Cc1cnc(C)c(NCCCC(C)Cl)n1 |
| InChI | InChI=1S/C11H18ClN3/c1-8(12)5-4-6-13-11-10(3)14-7-9(2)15-11/h7-8H,4-6H2,1-3H3,(H,13,15) |
| InChIKey | OJTLJOPBLKSBRR-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.74 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|