C15H20F3NO — CID 106124800
4-[[[2-(trifluoromethyl)phenyl]methylamino]methyl]cyclohexan-1-ol (PubChem CID 106124800) has the molecular formula C15H20F3NO and a molecular weight of 287.32 g/mol. Its IUPAC name is 4-[[[2-(trifluoromethyl)phenyl]methylamino]methyl]cyclohexan-1-ol.
| Compound Name | 4-[[[2-(trifluoromethyl)phenyl]methylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106124800 |
| Molecular Formula | C15H20F3NO |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 4-[[[2-(trifluoromethyl)phenyl]methylamino]methyl]cyclohexan-1-ol |
| SMILES | OC1CCC(CNCc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H20F3NO/c16-15(17,18)14-4-2-1-3-12(14)10-19-9-11-5-7-13(20)8-6-11/h1-4,11,13,19-20H,5-10H2 |
| InChIKey | RGLYZTCRWLHPGX-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |