C9H16F3N3O — CID 106124916
1-[(3-aminocyclopentyl)methyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 106124916) has the molecular formula C9H16F3N3O and a molecular weight of 239.24 g/mol. Its IUPAC name is 1-[(3-aminocyclopentyl)methyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[(3-aminocyclopentyl)methyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 106124916 |
| Molecular Formula | C9H16F3N3O |
| Molecular Weight | 239.24 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 1-[(3-aminocyclopentyl)methyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | NC1CCC(CNC(=O)NCC(F)(F)F)C1 |
| InChI | InChI=1S/C9H16F3N3O/c10-9(11,12)5-15-8(16)14-4-6-1-2-7(13)3-6/h6-7H,1-5,13H2,(H2,14,15,16) |
| InChIKey | VCMICDZHWGBNGD-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.24 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |