C18H28N2O — CID 106125778
4-[[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]methyl]cyclohexan-1-ol (PubChem CID 106125778) has the molecular formula C18H28N2O and a molecular weight of 288.43 g/mol. Its IUPAC name is 4-[[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]methyl]cyclohexan-1-ol.
| Compound Name | 4-[[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106125778 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | 4-[[(1-methyl-3,4-dihydro-2H-quinolin-6-yl)methylamino]methyl]cyclohexan-1-ol |
| SMILES | CN1CCCc2cc(CNCC3CCC(O)CC3)ccc21 |
| InChI | InChI=1S/C18H28N2O/c1-20-10-2-3-16-11-15(6-9-18(16)20)13-19-12-14-4-7-17(21)8-5-14/h6,9,11,14,17,19,21H,2-5,7-8,10,12-13H2,1H3 |
| InChIKey | JHRDNKCVOPBHNR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|