C15H23NO3S — CID 106126424
N-[(3-hydroxycyclohexyl)methyl]-3,5-dimethylbenzenesulfonamide (PubChem CID 106126424) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-[(3-hydroxycyclohexyl)methyl]-3,5-dimethylbenzenesulfonamide.
| Compound Name | N-[(3-hydroxycyclohexyl)methyl]-3,5-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106126424 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N-[(3-hydroxycyclohexyl)methyl]-3,5-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(C)cc(S(=O)(=O)NCC2CCCC(O)C2)c1 |
| InChI | InChI=1S/C15H23NO3S/c1-11-6-12(2)8-15(7-11)20(18,19)16-10-13-4-3-5-14(17)9-13/h6-8,13-14,16-17H,3-5,9-10H2,1-2H3 |
| InChIKey | QGDIKUZUEULRAP-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |