C17H17N3O — CID 10612712
5-(3-methoxy-2,4-dimethylpent-3-en-2-yl)benzene-1,2,4-tricarbonitrile (PubChem CID 10612712) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 5-(3-methoxy-2,4-dimethylpent-3-en-2-yl)benzene-1,2,4-tricarbonitrile.
| Compound Name | 5-(3-methoxy-2,4-dimethylpent-3-en-2-yl)benzene-1,2,4-tricarbonitrile |
|---|---|
| PubChem CID | 10612712 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 5-(3-methoxy-2,4-dimethylpent-3-en-2-yl)benzene-1,2,4-tricarbonitrile |
| SMILES | COC(=C(C)C)C(C)(C)c1cc(C#N)c(C#N)cc1C#N |
| InChI | InChI=1S/C17H17N3O/c1-11(2)16(21-5)17(3,4)15-7-13(9-19)12(8-18)6-14(15)10-20/h6-7H,1-5H3 |
| InChIKey | SGFLEESIRSCDIT-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 80.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|