C8H13F3N4S — CID 106127410
1-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pentane-1,4-diamine (PubChem CID 106127410) has the molecular formula C8H13F3N4S and a molecular weight of 254.28 g/mol. Its IUPAC name is 1-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pentane-1,4-diamine.
| Compound Name | 1-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pentane-1,4-diamine |
|---|---|
| PubChem CID | 106127410 |
| Molecular Formula | C8H13F3N4S |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | 1-N-[3-(trifluoromethyl)-1,2,4-thiadiazol-5-yl]pentane-1,4-diamine |
| SMILES | CC(N)CCCNc1nc(C(F)(F)F)ns1 |
| InChI | InChI=1S/C8H13F3N4S/c1-5(12)3-2-4-13-7-14-6(15-16-7)8(9,10)11/h5H,2-4,12H2,1H3,(H,13,14,15) |
| InChIKey | JWKKMCWFVQMTJY-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|