C12H16N4O4 — CID 10612747
(7S,8R)-8-hydroxy-11,13-dimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-2-one (PubChem CID 10612747) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is (7S,8R)-8-hydroxy-11,13-dimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-2-one.
| Compound Name | (7S,8R)-8-hydroxy-11,13-dimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-2-one |
|---|---|
| PubChem CID | 10612747 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | (7S,8R)-8-hydroxy-11,13-dimethoxy-3,9,12,14-tetrazatricyclo[8.4.0.03,7]tetradeca-1(10),11,13-trien-2-one |
| SMILES | COc1nc(OC)c2c(n1)C(=O)N1CCC[C@H]1[C@@H](O)N2 |
| InChI | InChI=1S/C12H16N4O4/c1-19-10-7-8(14-12(15-10)20-2)11(18)16-5-3-4-6(16)9(17)13-7/h6,9,13,17H,3-5H2,1-2H3/t6-,9+/m0/s1 |
| InChIKey | XZFQSRFZOVPZFR-IMTBSYHQSA-N |
| XLogP | -0.16 |
| TPSA | 96.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |