C11H20N3+ — CID 10612809
(1R,4S,6R,10S)-6,10-dimethyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene (PubChem CID 10612809) has the molecular formula C11H20N3+ and a molecular weight of 194.30 g/mol. Its IUPAC name is (1R,4S,6R,10S)-6,10-dimethyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene.
| Compound Name | (1R,4S,6R,10S)-6,10-dimethyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene |
|---|---|
| PubChem CID | 10612809 |
| Molecular Formula | C11H20N3+ |
| Molecular Weight | 194.30 g/mol |
| Exact Mass | 194.17 |
| IUPAC Name | (1R,4S,6R,10S)-6,10-dimethyl-7,9-diaza-12-azoniatricyclo[6.3.1.04,12]dodec-8(12)-ene |
| SMILES | C[C@@H]1C[C@@H]2CC[C@@H]3C[C@H](C)NC(=[N+]32)N1 |
| InChI | InChI=1S/C11H19N3/c1-7-5-9-3-4-10-6-8(2)13-11(12-7)14(9)10/h7-10H,3-6H2,1-2H3,(H,12,13)/p+1/t7-,8+,9+,10- |
| InChIKey | NMQGYKLVARCOKP-FIRGSJFUSA-O |
| XLogP | 0.65 |
| TPSA | 27.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.30 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|