C10H16BrN3O — CID 106130377
N-(4-bromopentyl)-2-methylpyrazole-3-carboxamide (PubChem CID 106130377) has the molecular formula C10H16BrN3O and a molecular weight of 274.16 g/mol. Its IUPAC name is N-(4-bromopentyl)-2-methylpyrazole-3-carboxamide.
| Compound Name | N-(4-bromopentyl)-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 106130377 |
| Molecular Formula | C10H16BrN3O |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 273.05 |
| IUPAC Name | N-(4-bromopentyl)-2-methylpyrazole-3-carboxamide |
| SMILES | CC(Br)CCCNC(=O)c1ccnn1C |
| InChI | InChI=1S/C10H16BrN3O/c1-8(11)4-3-6-12-10(15)9-5-7-13-14(9)2/h5,7-8H,3-4,6H2,1-2H3,(H,12,15) |
| InChIKey | YFPIWEFMVQFMRF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|