About 2,5-dihexylthiophene 1,1-dioxide
2,5-dihexylthiophene 1,1-dioxide (PubChem CID 10613089) has the molecular formula C16H28O2S
and a molecular weight of 284.46 g/mol. Its IUPAC name is 2,5-dihexylthiophene 1,1-dioxide.
Molecular Properties
| Compound Name | 2,5-dihexylthiophene 1,1-dioxide |
| PubChem CID | 10613089 |
| Molecular Formula | C16H28O2S |
| Molecular Weight | 284.46 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 2,5-dihexylthiophene 1,1-dioxide |
| SMILES | CCCCCCC1=CC=C(CCCCCC)S1(=O)=O |
| InChI | InChI=1S/C16H28O2S/c1-3-5-7-9-11-15-13-14-16(19(15,17)18)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | KYMWALYBWORUHD-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,5-dihexylthiophene 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dihexylthiophene 1,1-dioxide?
The IUPAC name of 2,5-dihexylthiophene 1,1-dioxide (CID 10613089) is 2,5-dihexylthiophene 1,1-dioxide.
What is the SMILES notation for 2,5-dihexylthiophene 1,1-dioxide?
The canonical SMILES for 2,5-dihexylthiophene 1,1-dioxide is CCCCCCC1=CC=C(CCCCCC)S1(=O)=O.
What is the InChIKey of 2,5-dihexylthiophene 1,1-dioxide?
The InChIKey is KYMWALYBWORUHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2S/c1-3-5-7-9-11-15-13-14-16(19(15,17)18)12-10-8-6-4-2/h13-14H,3-12H2,1-2H3.
What are the key properties of 2,5-dihexylthiophene 1,1-dioxide?
2,5-dihexylthiophene 1,1-dioxide has a molecular weight of 284.46 g/mol, XLogP of 5.12, 10 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dihexylthiophene 1,1-dioxide is sourced from PubChem (CID 10613089), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).