C18H17F2N — CID 10613134
6-(3,5-difluorophenyl)-2,2,4-trimethyl-1H-quinoline (PubChem CID 10613134) has the molecular formula C18H17F2N and a molecular weight of 285.34 g/mol. Its IUPAC name is 6-(3,5-difluorophenyl)-2,2,4-trimethyl-1H-quinoline.
| Compound Name | 6-(3,5-difluorophenyl)-2,2,4-trimethyl-1H-quinoline |
|---|---|
| PubChem CID | 10613134 |
| Molecular Formula | C18H17F2N |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | 6-(3,5-difluorophenyl)-2,2,4-trimethyl-1H-quinoline |
| SMILES | CC1=CC(C)(C)Nc2ccc(-c3cc(F)cc(F)c3)cc21 |
| InChI | InChI=1S/C18H17F2N/c1-11-10-18(2,3)21-17-5-4-12(8-16(11)17)13-6-14(19)9-15(20)7-13/h4-10,21H,1-3H3 |
| InChIKey | XFRVMTJXAGNUEA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |