C14H24BrN3O — CID 106132006
3-[[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methylamino]methyl]cyclohexan-1-ol (PubChem CID 106132006) has the molecular formula C14H24BrN3O and a molecular weight of 330.27 g/mol. Its IUPAC name is 3-[[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methylamino]methyl]cyclohexan-1-ol.
| Compound Name | 3-[[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106132006 |
| Molecular Formula | C14H24BrN3O |
| Molecular Weight | 330.27 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 3-[[(4-bromo-1-ethyl-3-methylpyrazol-5-yl)methylamino]methyl]cyclohexan-1-ol |
| SMILES | CCn1nc(C)c(Br)c1CNCC1CCCC(O)C1 |
| InChI | InChI=1S/C14H24BrN3O/c1-3-18-13(14(15)10(2)17-18)9-16-8-11-5-4-6-12(19)7-11/h11-12,16,19H,3-9H2,1-2H3 |
| InChIKey | QMSDADRSYHFPLA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.27 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |