C15H26ClNO — CID 106132007
N-[(3-chlorocyclohexyl)methyl]-2,2-dimethylcyclopentane-1-carboxamide (PubChem CID 106132007) has the molecular formula C15H26ClNO and a molecular weight of 271.83 g/mol. Its IUPAC name is N-[(3-chlorocyclohexyl)methyl]-2,2-dimethylcyclopentane-1-carboxamide.
| Compound Name | N-[(3-chlorocyclohexyl)methyl]-2,2-dimethylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 106132007 |
| Molecular Formula | C15H26ClNO |
| Molecular Weight | 271.83 g/mol |
| Exact Mass | 271.17 |
| IUPAC Name | N-[(3-chlorocyclohexyl)methyl]-2,2-dimethylcyclopentane-1-carboxamide |
| SMILES | CC1(C)CCCC1C(=O)NCC1CCCC(Cl)C1 |
| InChI | InChI=1S/C15H26ClNO/c1-15(2)8-4-7-13(15)14(18)17-10-11-5-3-6-12(16)9-11/h11-13H,3-10H2,1-2H3,(H,17,18) |
| InChIKey | WUQLUOBFHLTRJO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.83 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|