C10H21NO3 — CID 106132055
3-[(3-hydroxycyclohexyl)methylamino]propane-1,2-diol (PubChem CID 106132055) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is 3-[(3-hydroxycyclohexyl)methylamino]propane-1,2-diol.
| Compound Name | 3-[(3-hydroxycyclohexyl)methylamino]propane-1,2-diol |
|---|---|
| PubChem CID | 106132055 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 3-[(3-hydroxycyclohexyl)methylamino]propane-1,2-diol |
| SMILES | OCC(O)CNCC1CCCC(O)C1 |
| InChI | InChI=1S/C10H21NO3/c12-7-10(14)6-11-5-8-2-1-3-9(13)4-8/h8-14H,1-7H2 |
| InChIKey | WITHHDFQFJJYJE-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |