C14H16BrClN2O3 — CID 106132707
N-[(3-bromocyclohexyl)methyl]-4-chloro-2-nitrobenzamide (PubChem CID 106132707) has the molecular formula C14H16BrClN2O3 and a molecular weight of 375.65 g/mol. Its IUPAC name is N-[(3-bromocyclohexyl)methyl]-4-chloro-2-nitrobenzamide.
| Compound Name | N-[(3-bromocyclohexyl)methyl]-4-chloro-2-nitrobenzamide |
|---|---|
| PubChem CID | 106132707 |
| Molecular Formula | C14H16BrClN2O3 |
| Molecular Weight | 375.65 g/mol |
| Exact Mass | 374.00 |
| IUPAC Name | N-[(3-bromocyclohexyl)methyl]-4-chloro-2-nitrobenzamide |
| SMILES | O=C(NCC1CCCC(Br)C1)c1ccc(Cl)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H16BrClN2O3/c15-10-3-1-2-9(6-10)8-17-14(19)12-5-4-11(16)7-13(12)18(20)21/h4-5,7,9-10H,1-3,6,8H2,(H,17,19) |
| InChIKey | NUIVPCJWPFTWFH-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|