C16H21N3O2 — CID 10613286
1-[(3R,4R)-2,4-dimethylhex-1-en-3-yl]-4-phenyl-1,2,4-triazolidine-3,5-dione (PubChem CID 10613286) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is 1-[(3R,4R)-2,4-dimethylhex-1-en-3-yl]-4-phenyl-1,2,4-triazolidine-3,5-dione.
| Compound Name | 1-[(3R,4R)-2,4-dimethylhex-1-en-3-yl]-4-phenyl-1,2,4-triazolidine-3,5-dione |
|---|---|
| PubChem CID | 10613286 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | 1-[(3R,4R)-2,4-dimethylhex-1-en-3-yl]-4-phenyl-1,2,4-triazolidine-3,5-dione |
| SMILES | C=C(C)[C@@H]([C@H](C)CC)n1[nH]c(=O)n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C16H21N3O2/c1-5-12(4)14(11(2)3)19-16(21)18(15(20)17-19)13-9-7-6-8-10-13/h6-10,12,14H,2,5H2,1,3-4H3,(H,17,20)/t12-,14+/m1/s1 |
| InChIKey | FVBAGHJOCBNNSN-OCCSQVGLSA-N |
| XLogP | 2.49 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|