C12H5N3S3 — CID 10613290
2-(5-methylsulfanylthieno[3,2-b]thiophen-2-yl)ethene-1,1,2-tricarbonitrile (PubChem CID 10613290) has the molecular formula C12H5N3S3 and a molecular weight of 287.39 g/mol. Its IUPAC name is 2-(5-methylsulfanylthieno[3,2-b]thiophen-2-yl)ethene-1,1,2-tricarbonitrile.
| Compound Name | 2-(5-methylsulfanylthieno[3,2-b]thiophen-2-yl)ethene-1,1,2-tricarbonitrile |
|---|---|
| PubChem CID | 10613290 |
| Molecular Formula | C12H5N3S3 |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 286.96 |
| IUPAC Name | 2-(5-methylsulfanylthieno[3,2-b]thiophen-2-yl)ethene-1,1,2-tricarbonitrile |
| SMILES | CSc1cc2sc(C(C#N)=C(C#N)C#N)cc2s1 |
| InChI | InChI=1S/C12H5N3S3/c1-16-12-3-11-10(18-12)2-9(17-11)8(6-15)7(4-13)5-14/h2-3H,1H3 |
| InChIKey | ZGNOWGCRZIERRD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|