About methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate
methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate (PubChem CID 10613314) has the molecular formula C13H20O7
and a molecular weight of 288.30 g/mol. Its IUPAC name is methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate |
| PubChem CID | 10613314 |
| Molecular Formula | C13H20O7 |
| Molecular Weight | 288.30 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate |
| SMILES | COC(=O)C1OCC(C)(CO)COC(=O)CCCC1=O |
| InChI | InChI=1S/C13H20O7/c1-13(6-14)7-19-10(16)5-3-4-9(15)11(20-8-13)12(17)18-2/h11,14H,3-8H2,1-2H3 |
| InChIKey | UWVYRCHFJWMHRW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.30 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate?
The IUPAC name of methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate (CID 10613314) is methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate.
What is the SMILES notation for methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate?
The canonical SMILES for methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate is COC(=O)C1OCC(C)(CO)COC(=O)CCCC1=O.
What is the InChIKey of methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate?
The InChIKey is UWVYRCHFJWMHRW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O7/c1-13(6-14)7-19-10(16)5-3-4-9(15)11(20-8-13)12(17)18-2/h11,14H,3-8H2,1-2H3.
What are the key properties of methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate?
methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate has a molecular weight of 288.30 g/mol, XLogP of -0.16, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(hydroxymethyl)-3-methyl-7,11-dioxo-1,5-dioxacycloundecane-6-carboxylate is sourced from PubChem (CID 10613314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).