C14H22N2O — CID 106133296
4-[[(6-methyl-2-pyridinyl)methylamino]methyl]cyclohexan-1-ol (PubChem CID 106133296) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is 4-[[(6-methyl-2-pyridinyl)methylamino]methyl]cyclohexan-1-ol.
| Compound Name | 4-[[(6-methyl-2-pyridinyl)methylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 106133296 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 4-[[(6-methyl-2-pyridinyl)methylamino]methyl]cyclohexan-1-ol |
| SMILES | Cc1cccc(CNCC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C14H22N2O/c1-11-3-2-4-13(16-11)10-15-9-12-5-7-14(17)8-6-12/h2-4,12,14-15,17H,5-10H2,1H3 |
| InChIKey | YOFMKCRCFUGGFA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |