C18H24O3 — CID 10613356
(4bS,8aS)-2-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-1,4-dione (PubChem CID 10613356) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is (4bS,8aS)-2-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-1,4-dione.
| Compound Name | (4bS,8aS)-2-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-1,4-dione |
|---|---|
| PubChem CID | 10613356 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | (4bS,8aS)-2-methoxy-4b,8,8-trimethyl-5,6,7,8a,9,10-hexahydrophenanthrene-1,4-dione |
| SMILES | COC1=CC(=O)C2=C(CC[C@H]3C(C)(C)CCC[C@]23C)C1=O |
| InChI | InChI=1S/C18H24O3/c1-17(2)8-5-9-18(3)14(17)7-6-11-15(18)12(19)10-13(21-4)16(11)20/h10,14H,5-9H2,1-4H3/t14-,18-/m0/s1 |
| InChIKey | FQDCBPCGOVUCFH-KSSFIOAISA-N |
| XLogP | 3.59 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|