C14H32O2Si2 — CID 10613381
dimethyl-(2-methyl-1-pent-4-en-2-yloxypropyl)-trimethylsilyloxysilane (PubChem CID 10613381) has the molecular formula C14H32O2Si2 and a molecular weight of 288.58 g/mol. Its IUPAC name is dimethyl-(2-methyl-1-pent-4-en-2-yloxypropyl)-trimethylsilyloxysilane.
| Compound Name | dimethyl-(2-methyl-1-pent-4-en-2-yloxypropyl)-trimethylsilyloxysilane |
|---|---|
| PubChem CID | 10613381 |
| Molecular Formula | C14H32O2Si2 |
| Molecular Weight | 288.58 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | dimethyl-(2-methyl-1-pent-4-en-2-yloxypropyl)-trimethylsilyloxysilane |
| SMILES | C=CCC(C)OC(C(C)C)[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C14H32O2Si2/c1-10-11-13(4)15-14(12(2)3)18(8,9)16-17(5,6)7/h10,12-14H,1,11H2,2-9H3 |
| InChIKey | UWIYHHWGISMXGL-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.58 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|