C9H17F3N2O2 — CID 106134707
2-amino-3,3,3-trifluoro-N-(4-hydroxypentyl)-2-methylpropanamide (PubChem CID 106134707) has the molecular formula C9H17F3N2O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 2-amino-3,3,3-trifluoro-N-(4-hydroxypentyl)-2-methylpropanamide.
| Compound Name | 2-amino-3,3,3-trifluoro-N-(4-hydroxypentyl)-2-methylpropanamide |
|---|---|
| PubChem CID | 106134707 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 2-amino-3,3,3-trifluoro-N-(4-hydroxypentyl)-2-methylpropanamide |
| SMILES | CC(O)CCCNC(=O)C(C)(N)C(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2/c1-6(15)4-3-5-14-7(16)8(2,13)9(10,11)12/h6,15H,3-5,13H2,1-2H3,(H,14,16) |
| InChIKey | PGJIRNFPWIUOIS-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|