C13H10ClN3O3 — CID 10613553
5-(2-chlorophenyl)-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-2,4,7-trione (PubChem CID 10613553) has the molecular formula C13H10ClN3O3 and a molecular weight of 291.69 g/mol. Its IUPAC name is 5-(2-chlorophenyl)-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-2,4,7-trione.
| Compound Name | 5-(2-chlorophenyl)-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-2,4,7-trione |
|---|---|
| PubChem CID | 10613553 |
| Molecular Formula | C13H10ClN3O3 |
| Molecular Weight | 291.69 g/mol |
| Exact Mass | 291.04 |
| IUPAC Name | 5-(2-chlorophenyl)-1,5,6,8-tetrahydropyrido[2,3-d]pyrimidine-2,4,7-trione |
| SMILES | O=C1CC(c2ccccc2Cl)c2c([nH]c(=O)[nH]c2=O)N1 |
| InChI | InChI=1S/C13H10ClN3O3/c14-8-4-2-1-3-6(8)7-5-9(18)15-11-10(7)12(19)17-13(20)16-11/h1-4,7H,5H2,(H3,15,16,17,18,19,20) |
| InChIKey | RVJUEMJDWMQFFU-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 94.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.69 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |