C13H17N3O5 — CID 106136562
2-[(3-hydroxycyclohexyl)methylamino]-5-nitropyridine-4-carboxylic acid (PubChem CID 106136562) has the molecular formula C13H17N3O5 and a molecular weight of 295.30 g/mol. Its IUPAC name is 2-[(3-hydroxycyclohexyl)methylamino]-5-nitropyridine-4-carboxylic acid.
| Compound Name | 2-[(3-hydroxycyclohexyl)methylamino]-5-nitropyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 106136562 |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | 2-[(3-hydroxycyclohexyl)methylamino]-5-nitropyridine-4-carboxylic acid |
| SMILES | O=C(O)c1cc(NCC2CCCC(O)C2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H17N3O5/c17-9-3-1-2-8(4-9)6-14-12-5-10(13(18)19)11(7-15-12)16(20)21/h5,7-9,17H,1-4,6H2,(H,14,15)(H,18,19) |
| InChIKey | RLDUZOGKIGGAOP-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|