C13H19NO3S — CID 106137034
3-[[(3-hydroxycyclohexyl)methylamino]methyl]thiophene-2-carboxylic acid (PubChem CID 106137034) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is 3-[[(3-hydroxycyclohexyl)methylamino]methyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[(3-hydroxycyclohexyl)methylamino]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 106137034 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 3-[[(3-hydroxycyclohexyl)methylamino]methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1sccc1CNCC1CCCC(O)C1 |
| InChI | InChI=1S/C13H19NO3S/c15-11-3-1-2-9(6-11)7-14-8-10-4-5-18-12(10)13(16)17/h4-5,9,11,14-15H,1-3,6-8H2,(H,16,17) |
| InChIKey | OEEWXEKRYWWJON-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |