C12H22N2O3 — CID 106137098
2-[3-[(4-hydroxycyclohexyl)methylamino]azetidin-3-yl]acetic acid (PubChem CID 106137098) has the molecular formula C12H22N2O3 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-[3-[(4-hydroxycyclohexyl)methylamino]azetidin-3-yl]acetic acid.
| Compound Name | 2-[3-[(4-hydroxycyclohexyl)methylamino]azetidin-3-yl]acetic acid |
|---|---|
| PubChem CID | 106137098 |
| Molecular Formula | C12H22N2O3 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.16 |
| IUPAC Name | 2-[3-[(4-hydroxycyclohexyl)methylamino]azetidin-3-yl]acetic acid |
| SMILES | O=C(O)CC1(NCC2CCC(O)CC2)CNC1 |
| InChI | InChI=1S/C12H22N2O3/c15-10-3-1-9(2-4-10)6-14-12(5-11(16)17)7-13-8-12/h9-10,13-15H,1-8H2,(H,16,17) |
| InChIKey | SIAGVVOSVSZJJO-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |