C16H22O5 — CID 10613715
5-[[2-(cyclopenten-1-yl)-1,3-dioxolan-2-yl]methyl]-2,2,6-trimethyl-1,3-dioxin-4-one (PubChem CID 10613715) has the molecular formula C16H22O5 and a molecular weight of 294.35 g/mol. Its IUPAC name is 5-[[2-(cyclopenten-1-yl)-1,3-dioxolan-2-yl]methyl]-2,2,6-trimethyl-1,3-dioxin-4-one.
| Compound Name | 5-[[2-(cyclopenten-1-yl)-1,3-dioxolan-2-yl]methyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
|---|---|
| PubChem CID | 10613715 |
| Molecular Formula | C16H22O5 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.15 |
| IUPAC Name | 5-[[2-(cyclopenten-1-yl)-1,3-dioxolan-2-yl]methyl]-2,2,6-trimethyl-1,3-dioxin-4-one |
| SMILES | CC1=C(CC2(C3=CCCC3)OCCO2)C(=O)OC(C)(C)O1 |
| InChI | InChI=1S/C16H22O5/c1-11-13(14(17)21-15(2,3)20-11)10-16(18-8-9-19-16)12-6-4-5-7-12/h6H,4-5,7-10H2,1-3H3 |
| InChIKey | ANCSWXVTKULHEG-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|