C19H18O3 — CID 10613719
(4E,6E)-1,7-bis(4-hydroxyphenyl)hepta-4,6-dien-3-one (PubChem CID 10613719) has the molecular formula C19H18O3 and a molecular weight of 294.35 g/mol. Its IUPAC name is (4E,6E)-1,7-bis(4-hydroxyphenyl)hepta-4,6-dien-3-one.
| Compound Name | (4E,6E)-1,7-bis(4-hydroxyphenyl)hepta-4,6-dien-3-one |
|---|---|
| PubChem CID | 10613719 |
| Molecular Formula | C19H18O3 |
| Molecular Weight | 294.35 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | (4E,6E)-1,7-bis(4-hydroxyphenyl)hepta-4,6-dien-3-one |
| SMILES | O=C(/C=C/C=C/c1ccc(O)cc1)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H18O3/c20-17(10-7-16-8-13-19(22)14-9-16)4-2-1-3-15-5-11-18(21)12-6-15/h1-6,8-9,11-14,21-22H,7,10H2/b3-1+,4-2+ |
| InChIKey | QIROPQQWKBMABC-ZPUQHVIOSA-N |
| XLogP | 3.87 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.35 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|