About 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol
4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol (PubChem CID 106137434) has the molecular formula C9H14BrN3OS
and a molecular weight of 292.20 g/mol. Its IUPAC name is 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol |
| PubChem CID | 106137434 |
| Molecular Formula | C9H14BrN3OS |
| Molecular Weight | 292.20 g/mol |
| Exact Mass | 291.00 |
| IUPAC Name | 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol |
| SMILES | OC1CCC(CNc2nnc(Br)s2)CC1 |
| InChI | InChI=1S/C9H14BrN3OS/c10-8-12-13-9(15-8)11-5-6-1-3-7(14)4-2-6/h6-7,14H,1-5H2,(H,11,13) |
| InChIKey | VQDVCVIFULJJSF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol?
The IUPAC name of 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol (CID 106137434) is 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol.
What is the SMILES notation for 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol?
The canonical SMILES for 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol is OC1CCC(CNc2nnc(Br)s2)CC1.
What is the InChIKey of 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol?
The InChIKey is VQDVCVIFULJJSF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14BrN3OS/c10-8-12-13-9(15-8)11-5-6-1-3-7(14)4-2-6/h6-7,14H,1-5H2,(H,11,13).
What are the key properties of 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol?
4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol has a molecular weight of 292.20 g/mol, XLogP of 2.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(5-bromo-1,3,4-thiadiazol-2-yl)amino]methyl]cyclohexan-1-ol is sourced from PubChem (CID 106137434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).