C16H11ClN4 — CID 10613752
2-(4-chlorophenyl)pyrazolo[3,4-c]quinolin-4-amine (PubChem CID 10613752) has the molecular formula C16H11ClN4 and a molecular weight of 294.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)pyrazolo[3,4-c]quinolin-4-amine.
| Compound Name | 2-(4-chlorophenyl)pyrazolo[3,4-c]quinolin-4-amine |
|---|---|
| PubChem CID | 10613752 |
| Molecular Formula | C16H11ClN4 |
| Molecular Weight | 294.75 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 2-(4-chlorophenyl)pyrazolo[3,4-c]quinolin-4-amine |
| SMILES | Nc1nc2ccccc2c2cn(-c3ccc(Cl)cc3)nc12 |
| InChI | InChI=1S/C16H11ClN4/c17-10-5-7-11(8-6-10)21-9-13-12-3-1-2-4-14(12)19-16(18)15(13)20-21/h1-9H,(H2,18,19) |
| InChIKey | NLQSUGLAMHEOIM-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.75 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |