C14H21N3O3 — CID 106137977
3-[[3-(ethylamino)-2-nitroanilino]methyl]cyclopentan-1-ol (PubChem CID 106137977) has the molecular formula C14H21N3O3 and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-[[3-(ethylamino)-2-nitroanilino]methyl]cyclopentan-1-ol.
| Compound Name | 3-[[3-(ethylamino)-2-nitroanilino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 106137977 |
| Molecular Formula | C14H21N3O3 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 3-[[3-(ethylamino)-2-nitroanilino]methyl]cyclopentan-1-ol |
| SMILES | CCNc1cccc(NCC2CCC(O)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C14H21N3O3/c1-2-15-12-4-3-5-13(14(12)17(19)20)16-9-10-6-7-11(18)8-10/h3-5,10-11,15-16,18H,2,6-9H2,1H3 |
| InChIKey | HSKDGBYJLKRAOG-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|