About 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol
3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol (PubChem CID 106138792) has the molecular formula C12H18F2N4O
and a molecular weight of 272.30 g/mol. Its IUPAC name is 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol |
| PubChem CID | 106138792 |
| Molecular Formula | C12H18F2N4O |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol |
| SMILES | NNc1nc(NCC2CCCC(O)C2)c(F)cc1F |
| InChI | InChI=1S/C12H18F2N4O/c13-9-5-10(14)12(18-15)17-11(9)16-6-7-2-1-3-8(19)4-7/h5,7-8,19H,1-4,6,15H2,(H2,16,17,18) |
| InChIKey | HVCSVQIOHHWXDV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 83.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol?
The IUPAC name of 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol (CID 106138792) is 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol.
What is the SMILES notation for 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol?
The canonical SMILES for 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol is NNc1nc(NCC2CCCC(O)C2)c(F)cc1F.
What is the InChIKey of 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol?
The InChIKey is HVCSVQIOHHWXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18F2N4O/c13-9-5-10(14)12(18-15)17-11(9)16-6-7-2-1-3-8(19)4-7/h5,7-8,19H,1-4,6,15H2,(H2,16,17,18).
What are the key properties of 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol?
3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol has a molecular weight of 272.30 g/mol, XLogP of 1.61, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3,5-difluoro-6-hydrazinyl-2-pyridinyl)amino]methyl]cyclohexan-1-ol is sourced from PubChem (CID 106138792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).