C9H12ClN3O6S — CID 106139010
2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]pentanedioic acid (PubChem CID 106139010) has the molecular formula C9H12ClN3O6S and a molecular weight of 325.73 g/mol. Its IUPAC name is 2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]pentanedioic acid.
| Compound Name | 2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]pentanedioic acid |
|---|---|
| PubChem CID | 106139010 |
| Molecular Formula | C9H12ClN3O6S |
| Molecular Weight | 325.73 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 2-[(4-chloro-1-methylpyrazol-5-yl)sulfonylamino]pentanedioic acid |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)NC(CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H12ClN3O6S/c1-13-8(5(10)4-11-13)20(18,19)12-6(9(16)17)2-3-7(14)15/h4,6,12H,2-3H2,1H3,(H,14,15)(H,16,17) |
| InChIKey | YJPRQZITBXBKCR-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 138.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.73 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |