C13H19N3O5 — CID 10613930
N-[(2S)-1-hydrazinyl-3-hydroxy-1-oxobutan-2-yl]-2,4-dimethoxybenzamide (PubChem CID 10613930) has the molecular formula C13H19N3O5 and a molecular weight of 297.31 g/mol. Its IUPAC name is N-[(2S)-1-hydrazinyl-3-hydroxy-1-oxobutan-2-yl]-2,4-dimethoxybenzamide.
| Compound Name | N-[(2S)-1-hydrazinyl-3-hydroxy-1-oxobutan-2-yl]-2,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 10613930 |
| Molecular Formula | C13H19N3O5 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.13 |
| IUPAC Name | N-[(2S)-1-hydrazinyl-3-hydroxy-1-oxobutan-2-yl]-2,4-dimethoxybenzamide |
| SMILES | COc1ccc(C(=O)N[C@H](C(=O)NN)C(C)O)c(OC)c1 |
| InChI | InChI=1S/C13H19N3O5/c1-7(17)11(13(19)16-14)15-12(18)9-5-4-8(20-2)6-10(9)21-3/h4-7,11,17H,14H2,1-3H3,(H,15,18)(H,16,19)/t7?,11-/m0/s1 |
| InChIKey | VAZKEOZOFMIVPS-QRIDDKLISA-N |
| XLogP | -0.83 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|