C15H23NO3S — CID 10613961
N-[(E,2S,3R)-1,3-dihydroxy-5-thiophen-2-ylpent-4-en-2-yl]hexanamide (PubChem CID 10613961) has the molecular formula C15H23NO3S and a molecular weight of 297.42 g/mol. Its IUPAC name is N-[(E,2S,3R)-1,3-dihydroxy-5-thiophen-2-ylpent-4-en-2-yl]hexanamide.
| Compound Name | N-[(E,2S,3R)-1,3-dihydroxy-5-thiophen-2-ylpent-4-en-2-yl]hexanamide |
|---|---|
| PubChem CID | 10613961 |
| Molecular Formula | C15H23NO3S |
| Molecular Weight | 297.42 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | N-[(E,2S,3R)-1,3-dihydroxy-5-thiophen-2-ylpent-4-en-2-yl]hexanamide |
| SMILES | CCCCCC(=O)N[C@@H](CO)[C@H](O)/C=C/c1cccs1 |
| InChI | InChI=1S/C15H23NO3S/c1-2-3-4-7-15(19)16-13(11-17)14(18)9-8-12-6-5-10-20-12/h5-6,8-10,13-14,17-18H,2-4,7,11H2,1H3,(H,16,19)/b9-8+/t13-,14+/m0/s1 |
| InChIKey | JWGXNHWOYCDYHK-NYCDYWJRSA-N |
| XLogP | 2.18 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|