About N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide
N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide (PubChem CID 106139643) has the molecular formula C14H25F3N2O
and a molecular weight of 294.36 g/mol. Its IUPAC name is N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide.
Molecular Properties
| Compound Name | N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide |
| PubChem CID | 106139643 |
| Molecular Formula | C14H25F3N2O |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.19 |
| IUPAC Name | N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide |
| SMILES | CC(C)(CCN)CNC(=O)C1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C14H25F3N2O/c1-13(2,7-8-18)9-19-12(20)10-3-5-11(6-4-10)14(15,16)17/h10-11H,3-9,18H2,1-2H3,(H,19,20) |
| InChIKey | AOVOLBKTUULMIC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide?
The IUPAC name of N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide (CID 106139643) is N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide.
What is the SMILES notation for N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide?
The canonical SMILES for N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide is CC(C)(CCN)CNC(=O)C1CCC(C(F)(F)F)CC1.
What is the InChIKey of N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide?
The InChIKey is AOVOLBKTUULMIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25F3N2O/c1-13(2,7-8-18)9-19-12(20)10-3-5-11(6-4-10)14(15,16)17/h10-11H,3-9,18H2,1-2H3,(H,19,20).
What are the key properties of N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide?
N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide has a molecular weight of 294.36 g/mol, XLogP of 2.85, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-2,2-dimethylbutyl)-4-(trifluoromethyl)cyclohexane-1-carboxamide is sourced from PubChem (CID 106139643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).