C21H31N — CID 10613969
(3S,3aS,5aS,6S,8aR,10S,10aR,10bS,10cR)-3-isocyano-3,6,7,10-tetramethyl-2,3a,4,5,5a,6,8a,9,10,10a,10b,10c-dodecahydro-1H-pyrene (PubChem CID 10613969) has the molecular formula C21H31N and a molecular weight of 297.49 g/mol. Its IUPAC name is (3S,3aS,5aS,6S,8aR,10S,10aR,10bS,10cR)-3-isocyano-3,6,7,10-tetramethyl-2,3a,4,5,5a,6,8a,9,10,10a,10b,10c-dodecahydro-1H-pyrene.
| Compound Name | (3S,3aS,5aS,6S,8aR,10S,10aR,10bS,10cR)-3-isocyano-3,6,7,10-tetramethyl-2,3a,4,5,5a,6,8a,9,10,10a,10b,10c-dodecahydro-1H-pyrene |
|---|---|
| PubChem CID | 10613969 |
| Molecular Formula | C21H31N |
| Molecular Weight | 297.49 g/mol |
| Exact Mass | 297.25 |
| IUPAC Name | (3S,3aS,5aS,6S,8aR,10S,10aR,10bS,10cR)-3-isocyano-3,6,7,10-tetramethyl-2,3a,4,5,5a,6,8a,9,10,10a,10b,10c-dodecahydro-1H-pyrene |
| SMILES | [C-]#[N+][C@@]1(C)CC[C@H]2[C@H]3[C@@H]4[C@H](C=C(C)C(C)[C@H]4CC[C@@H]31)C[C@@H]2C |
| InChI | InChI=1S/C21H31N/c1-12-10-15-11-13(2)16-8-9-21(4,22-5)18-7-6-17(14(12)3)19(15)20(16)18/h10,13-20H,6-9,11H2,1-4H3/t13-,14?,15+,16+,17+,18-,19+,20+,21-/m0/s1 |
| InChIKey | MNCOLZSEANRVAD-GEBFWYFTSA-N |
| XLogP | 5.58 |
| TPSA | 4.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|