About benzhydrylbenzene
benzhydrylbenzene (PubChem CID 10614) has the molecular formula C19H16
and a molecular weight of 244.34 g/mol. Its IUPAC name is benzhydrylbenzene.
Molecular Properties
| Compound Name | benzhydrylbenzene |
| PubChem CID | 10614 |
| Molecular Formula | C19H16 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | benzhydrylbenzene |
| SMILES | c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H |
| InChIKey | AAAQKTZKLRYKHR-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|
Analyze benzhydrylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzhydrylbenzene?
The IUPAC name of benzhydrylbenzene (CID 10614) is benzhydrylbenzene.
What is the SMILES notation for benzhydrylbenzene?
The canonical SMILES for benzhydrylbenzene is c1ccc(C(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of benzhydrylbenzene?
The InChIKey is AAAQKTZKLRYKHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15,19H.
What are the key properties of benzhydrylbenzene?
benzhydrylbenzene has a molecular weight of 244.34 g/mol, XLogP of 4.87, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzhydrylbenzene is sourced from PubChem (CID 10614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).