About N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide
N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide (PubChem CID 106140031) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide.
Molecular Properties
| Compound Name | N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide |
| PubChem CID | 106140031 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide |
| SMILES | CC(C)(CCN)CNC(=O)c1c[nH]ccc1=O |
| InChI | InChI=1S/C12H19N3O2/c1-12(2,4-5-13)8-15-11(17)9-7-14-6-3-10(9)16/h3,6-7H,4-5,8,13H2,1-2H3,(H,14,16)(H,15,17) |
| InChIKey | ADLAPQRUDVZPCO-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 87.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide?
The IUPAC name of N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide (CID 106140031) is N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide.
What is the SMILES notation for N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide?
The canonical SMILES for N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide is CC(C)(CCN)CNC(=O)c1c[nH]ccc1=O.
What is the InChIKey of N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide?
The InChIKey is ADLAPQRUDVZPCO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-12(2,4-5-13)8-15-11(17)9-7-14-6-3-10(9)16/h3,6-7H,4-5,8,13H2,1-2H3,(H,14,16)(H,15,17).
What are the key properties of N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide?
N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide has a molecular weight of 237.30 g/mol, XLogP of 0.48, 5 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-2,2-dimethylbutyl)-4-oxo-1H-pyridine-3-carboxamide is sourced from PubChem (CID 106140031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).