C12H14N10 — CID 10614008
1,4-bis(2H-tetrazol-5-yl)-5,6,7,8,9,10-hexahydrocycloocta[d]pyridazine (PubChem CID 10614008) has the molecular formula C12H14N10 and a molecular weight of 298.31 g/mol. Its IUPAC name is 1,4-bis(2H-tetrazol-5-yl)-5,6,7,8,9,10-hexahydrocycloocta[d]pyridazine.
| Compound Name | 1,4-bis(2H-tetrazol-5-yl)-5,6,7,8,9,10-hexahydrocycloocta[d]pyridazine |
|---|---|
| PubChem CID | 10614008 |
| Molecular Formula | C12H14N10 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1,4-bis(2H-tetrazol-5-yl)-5,6,7,8,9,10-hexahydrocycloocta[d]pyridazine |
| SMILES | C1CCCc2c(-c3nn[nH]n3)nnc(-c3nn[nH]n3)c2CC1 |
| InChI | InChI=1S/C12H14N10/c1-2-4-6-8-7(5-3-1)9(11-15-19-20-16-11)13-14-10(8)12-17-21-22-18-12/h1-6H2,(H,15,16,19,20)(H,17,18,21,22) |
| InChIKey | UQPJOHZODCVEFY-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 134.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |