C11H21ClF3NO — CID 106140442
4-chloro-2,2-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]butan-1-amine (PubChem CID 106140442) has the molecular formula C11H21ClF3NO and a molecular weight of 275.74 g/mol. Its IUPAC name is 4-chloro-2,2-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]butan-1-amine.
| Compound Name | 4-chloro-2,2-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]butan-1-amine |
|---|---|
| PubChem CID | 106140442 |
| Molecular Formula | C11H21ClF3NO |
| Molecular Weight | 275.74 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 4-chloro-2,2-dimethyl-N-[3-(2,2,2-trifluoroethoxy)propyl]butan-1-amine |
| SMILES | CC(C)(CCCl)CNCCCOCC(F)(F)F |
| InChI | InChI=1S/C11H21ClF3NO/c1-10(2,4-5-12)8-16-6-3-7-17-9-11(13,14)15/h16H,3-9H2,1-2H3 |
| InChIKey | WMSPFDYCCATLQU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.74 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|