C9H18F3N3O — CID 106141202
1-(4-amino-2,2-dimethylbutyl)-3-(2,2,2-trifluoroethyl)urea (PubChem CID 106141202) has the molecular formula C9H18F3N3O and a molecular weight of 241.26 g/mol. Its IUPAC name is 1-(4-amino-2,2-dimethylbutyl)-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-(4-amino-2,2-dimethylbutyl)-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 106141202 |
| Molecular Formula | C9H18F3N3O |
| Molecular Weight | 241.26 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-(4-amino-2,2-dimethylbutyl)-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CC(C)(CCN)CNC(=O)NCC(F)(F)F |
| InChI | InChI=1S/C9H18F3N3O/c1-8(2,3-4-13)5-14-7(16)15-6-9(10,11)12/h3-6,13H2,1-2H3,(H2,14,15,16) |
| InChIKey | WOSQHUFVMONRIM-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.26 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |