About 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol
5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol (PubChem CID 106141475) has the molecular formula C13H20F3N3O
and a molecular weight of 291.32 g/mol. Its IUPAC name is 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol |
| PubChem CID | 106141475 |
| Molecular Formula | C13H20F3N3O |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol |
| SMILES | CC(C)(CCCO)CNc1cc(C(F)(F)F)ncc1N |
| InChI | InChI=1S/C13H20F3N3O/c1-12(2,4-3-5-20)8-19-10-6-11(13(14,15)16)18-7-9(10)17/h6-7,20H,3-5,8,17H2,1-2H3,(H,18,19) |
| InChIKey | BFHOOYKCGXLCNC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol?
The IUPAC name of 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol (CID 106141475) is 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol?
The canonical SMILES for 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol is CC(C)(CCCO)CNc1cc(C(F)(F)F)ncc1N.
What is the InChIKey of 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol?
The InChIKey is BFHOOYKCGXLCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20F3N3O/c1-12(2,4-3-5-20)8-19-10-6-11(13(14,15)16)18-7-9(10)17/h6-7,20H,3-5,8,17H2,1-2H3,(H,18,19).
What are the key properties of 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol?
5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol has a molecular weight of 291.32 g/mol, XLogP of 2.89, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[5-amino-2-(trifluoromethyl)-4-pyridinyl]amino]-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 106141475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).