About 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine
2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine (PubChem CID 106141764) has the molecular formula C10H25N3O2S
and a molecular weight of 251.40 g/mol. Its IUPAC name is 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine.
Molecular Properties
| Compound Name | 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine |
| PubChem CID | 106141764 |
| Molecular Formula | C10H25N3O2S |
| Molecular Weight | 251.40 g/mol |
| Exact Mass | 251.17 |
| IUPAC Name | 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine |
| SMILES | CC(C)NS(=O)(=O)NCC(C)(C)CCCN |
| InChI | InChI=1S/C10H25N3O2S/c1-9(2)13-16(14,15)12-8-10(3,4)6-5-7-11/h9,12-13H,5-8,11H2,1-4H3 |
| InChIKey | GRHWIHISNSDLER-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.40 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine?
The IUPAC name of 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine (CID 106141764) is 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine.
What is the SMILES notation for 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine?
The canonical SMILES for 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine is CC(C)NS(=O)(=O)NCC(C)(C)CCCN.
What is the InChIKey of 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine?
The InChIKey is GRHWIHISNSDLER-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H25N3O2S/c1-9(2)13-16(14,15)12-8-10(3,4)6-5-7-11/h9,12-13H,5-8,11H2,1-4H3.
What are the key properties of 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine?
2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine has a molecular weight of 251.40 g/mol, XLogP of 0.58, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethyl-N-(propan-2-ylsulfamoyl)pentane-1,5-diamine is sourced from PubChem (CID 106141764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).