C14H21ClN4 — CID 106142206
N-(5-chloro-2,2-dimethylpentyl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine (PubChem CID 106142206) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is N-(5-chloro-2,2-dimethylpentyl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine.
| Compound Name | N-(5-chloro-2,2-dimethylpentyl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine |
|---|---|
| PubChem CID | 106142206 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-(5-chloro-2,2-dimethylpentyl)-2-methylpyrazolo[1,5-a]pyrazin-4-amine |
| SMILES | Cc1cc2c(NCC(C)(C)CCCCl)nccn2n1 |
| InChI | InChI=1S/C14H21ClN4/c1-11-9-12-13(16-7-8-19(12)18-11)17-10-14(2,3)5-4-6-15/h7-9H,4-6,10H2,1-3H3,(H,16,17) |
| InChIKey | JAFANUUNHPUWDP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|