C10H9Cl2N5S — CID 10614281
5-amino-3-(2,4-dichlorophenyl)-N-methyl-1,2,4-triazole-1-carbothioamide (PubChem CID 10614281) has the molecular formula C10H9Cl2N5S and a molecular weight of 302.19 g/mol. Its IUPAC name is 5-amino-3-(2,4-dichlorophenyl)-N-methyl-1,2,4-triazole-1-carbothioamide.
| Compound Name | 5-amino-3-(2,4-dichlorophenyl)-N-methyl-1,2,4-triazole-1-carbothioamide |
|---|---|
| PubChem CID | 10614281 |
| Molecular Formula | C10H9Cl2N5S |
| Molecular Weight | 302.19 g/mol |
| Exact Mass | 301.00 |
| IUPAC Name | 5-amino-3-(2,4-dichlorophenyl)-N-methyl-1,2,4-triazole-1-carbothioamide |
| SMILES | CNC(=S)n1nc(-c2ccc(Cl)cc2Cl)nc1N |
| InChI | InChI=1S/C10H9Cl2N5S/c1-14-10(18)17-9(13)15-8(16-17)6-3-2-5(11)4-7(6)12/h2-4H,1H3,(H,14,18)(H2,13,15,16) |
| InChIKey | FUKJAFOLQOQQHH-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.19 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|