C15H27N3O2S — CID 106142885
2-[(5-amino-2,2-dimethylpentyl)amino]-N-ethylbenzenesulfonamide (PubChem CID 106142885) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is 2-[(5-amino-2,2-dimethylpentyl)amino]-N-ethylbenzenesulfonamide.
| Compound Name | 2-[(5-amino-2,2-dimethylpentyl)amino]-N-ethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106142885 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-[(5-amino-2,2-dimethylpentyl)amino]-N-ethylbenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccccc1NCC(C)(C)CCCN |
| InChI | InChI=1S/C15H27N3O2S/c1-4-18-21(19,20)14-9-6-5-8-13(14)17-12-15(2,3)10-7-11-16/h5-6,8-9,17-18H,4,7,10-12,16H2,1-3H3 |
| InChIKey | YVKMZGLOKMDPJI-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |