About 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine
3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine (PubChem CID 10614333) has the molecular formula C21H22N2
and a molecular weight of 302.42 g/mol. Its IUPAC name is 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine.
Molecular Properties
| Compound Name | 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine |
| PubChem CID | 10614333 |
| Molecular Formula | C21H22N2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.18 |
| IUPAC Name | 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine |
| SMILES | C(#Cc1cccnc1)CCCN1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C21H22N2/c1-4-10-20(11-5-1)21-12-16-23(17-13-21)15-6-2-3-8-19-9-7-14-22-18-19/h1,4-5,7,9-12,14,18H,2,6,13,15-17H2 |
| InChIKey | HJIACVVLQLKTJY-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine?
The IUPAC name of 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine (CID 10614333) is 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine.
What is the SMILES notation for 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine?
The canonical SMILES for 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine is C(#Cc1cccnc1)CCCN1CC=C(c2ccccc2)CC1.
What is the InChIKey of 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine?
The InChIKey is HJIACVVLQLKTJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H22N2/c1-4-10-20(11-5-1)21-12-16-23(17-13-21)15-6-2-3-8-19-9-7-14-22-18-19/h1,4-5,7,9-12,14,18H,2,6,13,15-17H2.
What are the key properties of 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine?
3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine has a molecular weight of 302.42 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)pent-1-ynyl]pyridine is sourced from PubChem (CID 10614333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).